C16H28O2 — CID 134158470
cis-(1S,2S)-1-methyl-4-propan-2-yl-1,2-bis(prop-2-enoxy)cyclohexane (PubChem CID 134158470) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is cis-(1S,2S)-1-methyl-4-propan-2-yl-1,2-bis(prop-2-enoxy)cyclohexane.
| Compound Name | cis-(1S,2S)-1-methyl-4-propan-2-yl-1,2-bis(prop-2-enoxy)cyclohexane |
|---|---|
| PubChem CID | 134158470 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | cis-(1S,2S)-1-methyl-4-propan-2-yl-1,2-bis(prop-2-enoxy)cyclohexane |
| SMILES | C=CCO[C@H]1CC(C(C)C)CC[C@]1(C)OCC=C |
| InChI | InChI=1S/C16H28O2/c1-6-10-17-15-12-14(13(3)4)8-9-16(15,5)18-11-7-2/h6-7,13-15H,1-2,8-12H2,3-5H3/t14?,15-,16-/m0/s1 |
| InChIKey | QBAJLTGOXJLXLQ-YVZMLIKISA-N |
| XLogP | 3.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|