C12H2F14O3 — CID 134158520
4,5,6,7-tetrafluoro-1,3-bis(1,1,2,2,2-pentafluoroethyl)-2-benzofuran-1,3-diol (PubChem CID 134158520) has the molecular formula C12H2F14O3 and a molecular weight of 460.12 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-1,3-bis(1,1,2,2,2-pentafluoroethyl)-2-benzofuran-1,3-diol.
| Compound Name | 4,5,6,7-tetrafluoro-1,3-bis(1,1,2,2,2-pentafluoroethyl)-2-benzofuran-1,3-diol |
|---|---|
| PubChem CID | 134158520 |
| Molecular Formula | C12H2F14O3 |
| Molecular Weight | 460.12 g/mol |
| Exact Mass | 459.98 |
| IUPAC Name | 4,5,6,7-tetrafluoro-1,3-bis(1,1,2,2,2-pentafluoroethyl)-2-benzofuran-1,3-diol |
| SMILES | OC1(C(F)(F)C(F)(F)F)OC(O)(C(F)(F)C(F)(F)F)c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C12H2F14O3/c13-3-1-2(4(14)6(16)5(3)15)8(28,10(19,20)12(24,25)26)29-7(1,27)9(17,18)11(21,22)23/h27-28H |
| InChIKey | PIFKIGCTMRRGIP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.12 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|