About (2R,3S)-2,3-bis(prop-2-enoxy)oxane
(2R,3S)-2,3-bis(prop-2-enoxy)oxane (PubChem CID 134158542) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is (2R,3S)-2,3-bis(prop-2-enoxy)oxane.
Molecular Properties
| Compound Name | (2R,3S)-2,3-bis(prop-2-enoxy)oxane |
| PubChem CID | 134158542 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (2R,3S)-2,3-bis(prop-2-enoxy)oxane |
| SMILES | C=CCO[C@H]1OCCC[C@@H]1OCC=C |
| InChI | InChI=1S/C11H18O3/c1-3-7-12-10-6-5-9-14-11(10)13-8-4-2/h3-4,10-11H,1-2,5-9H2/t10-,11-/m0/s1 |
| InChIKey | IBGIOMFOLMTEFK-QWRGUYRKSA-N |
| XLogP | 1.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-2,3-bis(prop-2-enoxy)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2,3-bis(prop-2-enoxy)oxane?
The IUPAC name of (2R,3S)-2,3-bis(prop-2-enoxy)oxane (CID 134158542) is (2R,3S)-2,3-bis(prop-2-enoxy)oxane.
What is the SMILES notation for (2R,3S)-2,3-bis(prop-2-enoxy)oxane?
The canonical SMILES for (2R,3S)-2,3-bis(prop-2-enoxy)oxane is C=CCO[C@H]1OCCC[C@@H]1OCC=C.
What is the InChIKey of (2R,3S)-2,3-bis(prop-2-enoxy)oxane?
The InChIKey is IBGIOMFOLMTEFK-QWRGUYRKSA-N. The full InChI is InChI=1S/C11H18O3/c1-3-7-12-10-6-5-9-14-11(10)13-8-4-2/h3-4,10-11H,1-2,5-9H2/t10-,11-/m0/s1.
What are the key properties of (2R,3S)-2,3-bis(prop-2-enoxy)oxane?
(2R,3S)-2,3-bis(prop-2-enoxy)oxane has a molecular weight of 198.26 g/mol, XLogP of 1.90, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2,3-bis(prop-2-enoxy)oxane is sourced from PubChem (CID 134158542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).