C20F16O — CID 134158738
1,3,4,5,6,7-hexafluoro-1,3-bis(2,3,4,5,6-pentafluorophenyl)-2-benzofuran (PubChem CID 134158738) has the molecular formula C20F16O and a molecular weight of 560.19 g/mol. Its IUPAC name is 1,3,4,5,6,7-hexafluoro-1,3-bis(2,3,4,5,6-pentafluorophenyl)-2-benzofuran.
| Compound Name | 1,3,4,5,6,7-hexafluoro-1,3-bis(2,3,4,5,6-pentafluorophenyl)-2-benzofuran |
|---|---|
| PubChem CID | 134158738 |
| Molecular Formula | C20F16O |
| Molecular Weight | 560.19 g/mol |
| Exact Mass | 559.97 |
| IUPAC Name | 1,3,4,5,6,7-hexafluoro-1,3-bis(2,3,4,5,6-pentafluorophenyl)-2-benzofuran |
| SMILES | Fc1c(F)c(F)c(C2(F)OC(F)(c3c(F)c(F)c(F)c(F)c3F)c3c(F)c(F)c(F)c(F)c32)c(F)c1F |
| InChI | InChI=1S/C20F16O/c21-5-1-2(6(22)12(28)11(5)27)20(36,4-9(25)15(31)18(34)16(32)10(4)26)37-19(1,35)3-7(23)13(29)17(33)14(30)8(3)24 |
| InChIKey | WOGWDOFZMDVVGY-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.19 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|