C12H9KN4O — CID 134158863
potassium 2-(2,2-dimethylpropanoyl)prop-1-ene-1,1,3,3-tetracarbonitrile (PubChem CID 134158863) has the molecular formula C12H9KN4O and a molecular weight of 264.33 g/mol. Its IUPAC name is potassium 2-(2,2-dimethylpropanoyl)prop-1-ene-1,1,3,3-tetracarbonitrile.
| Compound Name | potassium 2-(2,2-dimethylpropanoyl)prop-1-ene-1,1,3,3-tetracarbonitrile |
|---|---|
| PubChem CID | 134158863 |
| Molecular Formula | C12H9KN4O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | potassium 2-(2,2-dimethylpropanoyl)prop-1-ene-1,1,3,3-tetracarbonitrile |
| SMILES | CC(C)(C)C(=O)C(=C(C#N)C#N)[C-](C#N)C#N.[K+] |
| InChI | InChI=1S/C12H9N4O.K/c1-12(2,3)11(17)10(8(4-13)5-14)9(6-15)7-16;/h1-3H3;/q-1;+1 |
| InChIKey | ZVMKVJDVTBZWRU-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 112.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|