C29H42O — CID 134159511
4-prop-2-enyl-2,6-bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol (PubChem CID 134159511) has the molecular formula C29H42O and a molecular weight of 406.65 g/mol. Its IUPAC name is 4-prop-2-enyl-2,6-bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol.
| Compound Name | 4-prop-2-enyl-2,6-bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol |
|---|---|
| PubChem CID | 134159511 |
| Molecular Formula | C29H42O |
| Molecular Weight | 406.65 g/mol |
| Exact Mass | 406.32 |
| IUPAC Name | 4-prop-2-enyl-2,6-bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol |
| SMILES | C=CCc1cc(C2CC3CCC2(C)C3(C)C)c(O)c(C2CC3CCC2(C)C3(C)C)c1 |
| InChI | InChI=1S/C29H42O/c1-8-9-18-14-21(23-16-19-10-12-28(23,6)26(19,2)3)25(30)22(15-18)24-17-20-11-13-29(24,7)27(20,4)5/h8,14-15,19-20,23-24,30H,1,9-13,16-17H2,2-7H3 |
| InChIKey | ACGVEZMSVJVGGU-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.65 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|