About (3R,4S)-3-butyloxan-4-ol
(3R,4S)-3-butyloxan-4-ol (PubChem CID 134159604) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is (3R,4S)-3-butyloxan-4-ol.
Molecular Properties
| Compound Name | (3R,4S)-3-butyloxan-4-ol |
| PubChem CID | 134159604 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | (3R,4S)-3-butyloxan-4-ol |
| SMILES | CCCC[C@@H]1COCC[C@@H]1O |
| InChI | InChI=1S/C9H18O2/c1-2-3-4-8-7-11-6-5-9(8)10/h8-10H,2-7H2,1H3/t8-,9+/m1/s1 |
| InChIKey | MWFVMVJSGGIDDJ-BDAKNGLRSA-N |
| XLogP | 1.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,4S)-3-butyloxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-3-butyloxan-4-ol?
The IUPAC name of (3R,4S)-3-butyloxan-4-ol (CID 134159604) is (3R,4S)-3-butyloxan-4-ol.
What is the SMILES notation for (3R,4S)-3-butyloxan-4-ol?
The canonical SMILES for (3R,4S)-3-butyloxan-4-ol is CCCC[C@@H]1COCC[C@@H]1O.
What is the InChIKey of (3R,4S)-3-butyloxan-4-ol?
The InChIKey is MWFVMVJSGGIDDJ-BDAKNGLRSA-N. The full InChI is InChI=1S/C9H18O2/c1-2-3-4-8-7-11-6-5-9(8)10/h8-10H,2-7H2,1H3/t8-,9+/m1/s1.
What are the key properties of (3R,4S)-3-butyloxan-4-ol?
(3R,4S)-3-butyloxan-4-ol has a molecular weight of 158.24 g/mol, XLogP of 1.57, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-3-butyloxan-4-ol is sourced from PubChem (CID 134159604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).