C24H32N8O6 — CID 134159782
(2S)-2-amino-5-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[2-(3-carbamoylphenyl)ethyl]amino]pentanoic acid (PubChem CID 134159782) has the molecular formula C24H32N8O6 and a molecular weight of 528.57 g/mol. Its IUPAC name is (2S)-2-amino-5-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[2-(3-carbamoylphenyl)ethyl]amino]pentanoic acid.
| Compound Name | (2S)-2-amino-5-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[2-(3-carbamoylphenyl)ethyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 134159782 |
| Molecular Formula | C24H32N8O6 |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | (2S)-2-amino-5-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-[2-(3-carbamoylphenyl)ethyl]amino]pentanoic acid |
| SMILES | NC(=O)c1cccc(CCN(CCC[C@H](N)C(=O)O)C[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C24H32N8O6/c25-15(24(36)37)5-2-7-31(8-6-13-3-1-4-14(9-13)21(27)35)10-16-18(33)19(34)23(38-16)32-12-30-17-20(26)28-11-29-22(17)32/h1,3-4,9,11-12,15-16,18-19,23,33-34H,2,5-8,10,25H2,(H2,27,35)(H,36,37)(H2,26,28,29)/t15-,16+,18+,19+,23+/m0/s1 |
| InChIKey | HSCPXDPGPWYINM-NMNPZVDOSA-N |
| XLogP | -1.14 |
| TPSA | 228.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |