About 2-tert-butyl-4,6-dimethyl-4-nitrocyclohexa-2,5-dien-1-one
2-tert-butyl-4,6-dimethyl-4-nitrocyclohexa-2,5-dien-1-one (PubChem CID 13416007) has the molecular formula C12H17NO3
and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-tert-butyl-4,6-dimethyl-4-nitrocyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 2-tert-butyl-4,6-dimethyl-4-nitrocyclohexa-2,5-dien-1-one |
| PubChem CID | 13416007 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-tert-butyl-4,6-dimethyl-4-nitrocyclohexa-2,5-dien-1-one |
| SMILES | CC1=CC(C)([N+](=O)[O-])C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C12H17NO3/c1-8-6-12(5,13(15)16)7-9(10(8)14)11(2,3)4/h6-7H,1-5H3 |
| InChIKey | OHNSEXODFYVCEY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-4,6-dimethyl-4-nitrocyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4,6-dimethyl-4-nitrocyclohexa-2,5-dien-1-one?
The IUPAC name of 2-tert-butyl-4,6-dimethyl-4-nitrocyclohexa-2,5-dien-1-one (CID 13416007) is 2-tert-butyl-4,6-dimethyl-4-nitrocyclohexa-2,5-dien-1-one.
What is the SMILES notation for 2-tert-butyl-4,6-dimethyl-4-nitrocyclohexa-2,5-dien-1-one?
The canonical SMILES for 2-tert-butyl-4,6-dimethyl-4-nitrocyclohexa-2,5-dien-1-one is CC1=CC(C)([N+](=O)[O-])C=C(C(C)(C)C)C1=O.
What is the InChIKey of 2-tert-butyl-4,6-dimethyl-4-nitrocyclohexa-2,5-dien-1-one?
The InChIKey is OHNSEXODFYVCEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3/c1-8-6-12(5,13(15)16)7-9(10(8)14)11(2,3)4/h6-7H,1-5H3.
What are the key properties of 2-tert-butyl-4,6-dimethyl-4-nitrocyclohexa-2,5-dien-1-one?
2-tert-butyl-4,6-dimethyl-4-nitrocyclohexa-2,5-dien-1-one has a molecular weight of 223.27 g/mol, XLogP of 2.52, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4,6-dimethyl-4-nitrocyclohexa-2,5-dien-1-one is sourced from PubChem (CID 13416007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).