C21H13Cl4N3O3 — CID 134160199
N-quinolin-8-yl-4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 134160199) has the molecular formula C21H13Cl4N3O3 and a molecular weight of 497.17 g/mol. Its IUPAC name is N-quinolin-8-yl-4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-quinolin-8-yl-4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 134160199 |
| Molecular Formula | C21H13Cl4N3O3 |
| Molecular Weight | 497.17 g/mol |
| Exact Mass | 494.97 |
| IUPAC Name | N-quinolin-8-yl-4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C21H13Cl4N3O3/c22-15-13-14(16(23)18(25)17(15)24)21(31)28(20(13)30)9-3-7-12(29)27-11-6-1-4-10-5-2-8-26-19(10)11/h1-2,4-6,8H,3,7,9H2,(H,27,29) |
| InChIKey | WNFHPJRKNCCXCL-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.17 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|