C13H16ClNO2 — CID 134160663
2-(2-chlorophenyl)-1-(1,4-oxazepan-4-yl)ethanone (PubChem CID 134160663) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-(1,4-oxazepan-4-yl)ethanone.
| Compound Name | 2-(2-chlorophenyl)-1-(1,4-oxazepan-4-yl)ethanone |
|---|---|
| PubChem CID | 134160663 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-(2-chlorophenyl)-1-(1,4-oxazepan-4-yl)ethanone |
| SMILES | O=C(Cc1ccccc1Cl)N1CCCOCC1 |
| InChI | InChI=1S/C13H16ClNO2/c14-12-5-2-1-4-11(12)10-13(16)15-6-3-8-17-9-7-15/h1-2,4-5H,3,6-10H2 |
| InChIKey | KQGOYHAZUCOWNG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |