C11H12N4 — CID 134160674
6-methyl-N-(5-methyl-2-pyridinyl)pyrimidin-4-amine (PubChem CID 134160674) has the molecular formula C11H12N4 and a molecular weight of 200.24 g/mol. Its IUPAC name is 6-methyl-N-(5-methyl-2-pyridinyl)pyrimidin-4-amine.
| Compound Name | 6-methyl-N-(5-methyl-2-pyridinyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 134160674 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 6-methyl-N-(5-methyl-2-pyridinyl)pyrimidin-4-amine |
| SMILES | Cc1ccc(Nc2cc(C)ncn2)nc1 |
| InChI | InChI=1S/C11H12N4/c1-8-3-4-10(12-6-8)15-11-5-9(2)13-7-14-11/h3-7H,1-2H3,(H,12,13,14,15) |
| InChIKey | WGCJNYYVGMRESF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |