C19H18N4O2S — CID 134161482
4-(2-ethyl-1,3-benzothiazole-6-carbonyl)-1-pyridin-2-ylpiperazin-2-one (PubChem CID 134161482) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 4-(2-ethyl-1,3-benzothiazole-6-carbonyl)-1-pyridin-2-ylpiperazin-2-one.
| Compound Name | 4-(2-ethyl-1,3-benzothiazole-6-carbonyl)-1-pyridin-2-ylpiperazin-2-one |
|---|---|
| PubChem CID | 134161482 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4-(2-ethyl-1,3-benzothiazole-6-carbonyl)-1-pyridin-2-ylpiperazin-2-one |
| SMILES | CCc1nc2ccc(C(=O)N3CCN(c4ccccn4)C(=O)C3)cc2s1 |
| InChI | InChI=1S/C19H18N4O2S/c1-2-17-21-14-7-6-13(11-15(14)26-17)19(25)22-9-10-23(18(24)12-22)16-5-3-4-8-20-16/h3-8,11H,2,9-10,12H2,1H3 |
| InChIKey | ALULJLHKJUFSKR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |