C19H22N2O5 — CID 134161806
N'-[(4-hydroxy-6,7-dihydro-5H-1-benzofuran-4-yl)methyl]-N-[(2-methoxyphenyl)methyl]oxamide (PubChem CID 134161806) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is N'-[(4-hydroxy-6,7-dihydro-5H-1-benzofuran-4-yl)methyl]-N-[(2-methoxyphenyl)methyl]oxamide.
| Compound Name | N'-[(4-hydroxy-6,7-dihydro-5H-1-benzofuran-4-yl)methyl]-N-[(2-methoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 134161806 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N'-[(4-hydroxy-6,7-dihydro-5H-1-benzofuran-4-yl)methyl]-N-[(2-methoxyphenyl)methyl]oxamide |
| SMILES | COc1ccccc1CNC(=O)C(=O)NCC1(O)CCCc2occc21 |
| InChI | InChI=1S/C19H22N2O5/c1-25-15-6-3-2-5-13(15)11-20-17(22)18(23)21-12-19(24)9-4-7-16-14(19)8-10-26-16/h2-3,5-6,8,10,24H,4,7,9,11-12H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | JHQBGOFQWPMJDG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|