C11H10FNO3 — CID 13416183
1-carbamoyl-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid (PubChem CID 13416183) has the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. Its IUPAC name is 1-carbamoyl-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-carbamoyl-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 13416183 |
| Molecular Formula | C11H10FNO3 |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 1-carbamoyl-2-(4-fluorophenyl)cyclopropane-1-carboxylic acid |
| SMILES | NC(=O)C1(C(=O)O)CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C11H10FNO3/c12-7-3-1-6(2-4-7)8-5-11(8,9(13)14)10(15)16/h1-4,8H,5H2,(H2,13,14)(H,15,16) |
| InChIKey | WVOJRZMURIMREU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|