About 2-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]pyridazin-3-one
2-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]pyridazin-3-one (PubChem CID 134162343) has the molecular formula C10H10F3N3O2
and a molecular weight of 261.20 g/mol. Its IUPAC name is 2-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]pyridazin-3-one.
Molecular Properties
| Compound Name | 2-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]pyridazin-3-one |
| PubChem CID | 134162343 |
| Molecular Formula | C10H10F3N3O2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]pyridazin-3-one |
| SMILES | O=C(N1CC(Cn2ncccc2=O)C1)C(F)(F)F |
| InChI | InChI=1S/C10H10F3N3O2/c11-10(12,13)9(18)15-4-7(5-15)6-16-8(17)2-1-3-14-16/h1-3,7H,4-6H2 |
| InChIKey | BZRHYTXUDALTED-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]pyridazin-3-one?
The IUPAC name of 2-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]pyridazin-3-one (CID 134162343) is 2-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]pyridazin-3-one.
What is the SMILES notation for 2-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]pyridazin-3-one?
The canonical SMILES for 2-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]pyridazin-3-one is O=C(N1CC(Cn2ncccc2=O)C1)C(F)(F)F.
What is the InChIKey of 2-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]pyridazin-3-one?
The InChIKey is BZRHYTXUDALTED-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3N3O2/c11-10(12,13)9(18)15-4-7(5-15)6-16-8(17)2-1-3-14-16/h1-3,7H,4-6H2.
What are the key properties of 2-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]pyridazin-3-one?
2-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]pyridazin-3-one has a molecular weight of 261.20 g/mol, XLogP of 0.26, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(2,2,2-trifluoroacetyl)azetidin-3-yl]methyl]pyridazin-3-one is sourced from PubChem (CID 134162343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).