About 1-(bromomethyl)-4-(3,3-difluorocyclobutyl)benzene
1-(bromomethyl)-4-(3,3-difluorocyclobutyl)benzene (PubChem CID 134163283) has the molecular formula C11H11BrF2
and a molecular weight of 261.11 g/mol. Its IUPAC name is 1-(bromomethyl)-4-(3,3-difluorocyclobutyl)benzene.
Molecular Properties
| Compound Name | 1-(bromomethyl)-4-(3,3-difluorocyclobutyl)benzene |
| PubChem CID | 134163283 |
| Molecular Formula | C11H11BrF2 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 1-(bromomethyl)-4-(3,3-difluorocyclobutyl)benzene |
| SMILES | FC1(F)CC(c2ccc(CBr)cc2)C1 |
| InChI | InChI=1S/C11H11BrF2/c12-7-8-1-3-9(4-2-8)10-5-11(13,14)6-10/h1-4,10H,5-7H2 |
| InChIKey | OLYODJIWFWIFQT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(bromomethyl)-4-(3,3-difluorocyclobutyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(bromomethyl)-4-(3,3-difluorocyclobutyl)benzene?
The IUPAC name of 1-(bromomethyl)-4-(3,3-difluorocyclobutyl)benzene (CID 134163283) is 1-(bromomethyl)-4-(3,3-difluorocyclobutyl)benzene.
What is the SMILES notation for 1-(bromomethyl)-4-(3,3-difluorocyclobutyl)benzene?
The canonical SMILES for 1-(bromomethyl)-4-(3,3-difluorocyclobutyl)benzene is FC1(F)CC(c2ccc(CBr)cc2)C1.
What is the InChIKey of 1-(bromomethyl)-4-(3,3-difluorocyclobutyl)benzene?
The InChIKey is OLYODJIWFWIFQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrF2/c12-7-8-1-3-9(4-2-8)10-5-11(13,14)6-10/h1-4,10H,5-7H2.
What are the key properties of 1-(bromomethyl)-4-(3,3-difluorocyclobutyl)benzene?
1-(bromomethyl)-4-(3,3-difluorocyclobutyl)benzene has a molecular weight of 261.11 g/mol, XLogP of 4.09, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(bromomethyl)-4-(3,3-difluorocyclobutyl)benzene is sourced from PubChem (CID 134163283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).