C19H26F3NO3 — CID 134163440
tert-butyl 7-[4-[N-hydroxy-C-(trifluoromethyl)carbonimidoyl]phenyl]heptanoate (PubChem CID 134163440) has the molecular formula C19H26F3NO3 and a molecular weight of 373.42 g/mol. Its IUPAC name is tert-butyl 7-[4-[N-hydroxy-C-(trifluoromethyl)carbonimidoyl]phenyl]heptanoate.
| Compound Name | tert-butyl 7-[4-[N-hydroxy-C-(trifluoromethyl)carbonimidoyl]phenyl]heptanoate |
|---|---|
| PubChem CID | 134163440 |
| Molecular Formula | C19H26F3NO3 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | tert-butyl 7-[4-[N-hydroxy-C-(trifluoromethyl)carbonimidoyl]phenyl]heptanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCCc1ccc(C(=NO)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H26F3NO3/c1-18(2,3)26-16(24)9-7-5-4-6-8-14-10-12-15(13-11-14)17(23-25)19(20,21)22/h10-13,25H,4-9H2,1-3H3 |
| InChIKey | PKEFTCBXDIRMAQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|