About 6-[(E,4S)-4-hydroxy-3-oxopent-1-enyl]pyran-2-one
6-[(E,4S)-4-hydroxy-3-oxopent-1-enyl]pyran-2-one (PubChem CID 134163447) has the molecular formula C10H10O4
and a molecular weight of 194.19 g/mol. Its IUPAC name is 6-[(E,4S)-4-hydroxy-3-oxopent-1-enyl]pyran-2-one.
Molecular Properties
| Compound Name | 6-[(E,4S)-4-hydroxy-3-oxopent-1-enyl]pyran-2-one |
| PubChem CID | 134163447 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 6-[(E,4S)-4-hydroxy-3-oxopent-1-enyl]pyran-2-one |
| SMILES | C[C@H](O)C(=O)/C=C/c1cccc(=O)o1 |
| InChI | InChI=1S/C10H10O4/c1-7(11)9(12)6-5-8-3-2-4-10(13)14-8/h2-7,11H,1H3/b6-5+/t7-/m0/s1 |
| InChIKey | IBNFFIKIHHCABM-XPPMVYLVSA-N |
| XLogP | 0.60 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-[(E,4S)-4-hydroxy-3-oxopent-1-enyl]pyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(E,4S)-4-hydroxy-3-oxopent-1-enyl]pyran-2-one?
The IUPAC name of 6-[(E,4S)-4-hydroxy-3-oxopent-1-enyl]pyran-2-one (CID 134163447) is 6-[(E,4S)-4-hydroxy-3-oxopent-1-enyl]pyran-2-one.
What is the SMILES notation for 6-[(E,4S)-4-hydroxy-3-oxopent-1-enyl]pyran-2-one?
The canonical SMILES for 6-[(E,4S)-4-hydroxy-3-oxopent-1-enyl]pyran-2-one is C[C@H](O)C(=O)/C=C/c1cccc(=O)o1.
What is the InChIKey of 6-[(E,4S)-4-hydroxy-3-oxopent-1-enyl]pyran-2-one?
The InChIKey is IBNFFIKIHHCABM-XPPMVYLVSA-N. The full InChI is InChI=1S/C10H10O4/c1-7(11)9(12)6-5-8-3-2-4-10(13)14-8/h2-7,11H,1H3/b6-5+/t7-/m0/s1.
What are the key properties of 6-[(E,4S)-4-hydroxy-3-oxopent-1-enyl]pyran-2-one?
6-[(E,4S)-4-hydroxy-3-oxopent-1-enyl]pyran-2-one has a molecular weight of 194.19 g/mol, XLogP of 0.60, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(E,4S)-4-hydroxy-3-oxopent-1-enyl]pyran-2-one is sourced from PubChem (CID 134163447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).