C28H41N7O — CID 134163777
5-[(4-aminocyclohexyl)methyl]-3-(butylamino)-8-[(4-methylpiperazin-1-yl)methyl]pyrimido[4,5-c]isoquinolin-6-one (PubChem CID 134163777) has the molecular formula C28H41N7O and a molecular weight of 491.68 g/mol. Its IUPAC name is 5-[(4-aminocyclohexyl)methyl]-3-(butylamino)-8-[(4-methylpiperazin-1-yl)methyl]pyrimido[4,5-c]isoquinolin-6-one.
| Compound Name | 5-[(4-aminocyclohexyl)methyl]-3-(butylamino)-8-[(4-methylpiperazin-1-yl)methyl]pyrimido[4,5-c]isoquinolin-6-one |
|---|---|
| PubChem CID | 134163777 |
| Molecular Formula | C28H41N7O |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.34 |
| IUPAC Name | 5-[(4-aminocyclohexyl)methyl]-3-(butylamino)-8-[(4-methylpiperazin-1-yl)methyl]pyrimido[4,5-c]isoquinolin-6-one |
| SMILES | CCCCNc1ncc2c3ccc(CN4CCN(C)CC4)cc3c(=O)n(CC3CCC(N)CC3)c2n1 |
| InChI | InChI=1S/C28H41N7O/c1-3-4-11-30-28-31-17-25-23-10-7-21(18-34-14-12-33(2)13-15-34)16-24(23)27(36)35(26(25)32-28)19-20-5-8-22(29)9-6-20/h7,10,16-17,20,22H,3-6,8-9,11-15,18-19,29H2,1-2H3,(H,30,31,32) |
| InChIKey | HQYUMHZMFPEZRK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|