About 3-(butylamino)-5-(4-oxocyclohexyl)-8-piperazin-1-ylpyrimido[4,5-c]isoquinolin-6-one
3-(butylamino)-5-(4-oxocyclohexyl)-8-piperazin-1-ylpyrimido[4,5-c]isoquinolin-6-one (PubChem CID 134163812) has the molecular formula C25H32N6O2
and a molecular weight of 448.57 g/mol. Its IUPAC name is 3-(butylamino)-5-(4-oxocyclohexyl)-8-piperazin-1-ylpyrimido[4,5-c]isoquinolin-6-one.
Molecular Properties
| Compound Name | 3-(butylamino)-5-(4-oxocyclohexyl)-8-piperazin-1-ylpyrimido[4,5-c]isoquinolin-6-one |
| PubChem CID | 134163812 |
| Molecular Formula | C25H32N6O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | 3-(butylamino)-5-(4-oxocyclohexyl)-8-piperazin-1-ylpyrimido[4,5-c]isoquinolin-6-one |
| SMILES | CCCCNc1ncc2c3ccc(N4CCNCC4)cc3c(=O)n(C3CCC(=O)CC3)c2n1 |
| InChI | InChI=1S/C25H32N6O2/c1-2-3-10-27-25-28-16-22-20-9-6-18(30-13-11-26-12-14-30)15-21(20)24(33)31(23(22)29-25)17-4-7-19(32)8-5-17/h6,9,15-17,26H,2-5,7-8,10-14H2,1H3,(H,27,28,29) |
| InChIKey | ZHDSEZKUKCXQEI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-(butylamino)-5-(4-oxocyclohexyl)-8-piperazin-1-ylpyrimido[4,5-c]isoquinolin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(butylamino)-5-(4-oxocyclohexyl)-8-piperazin-1-ylpyrimido[4,5-c]isoquinolin-6-one?
The IUPAC name of 3-(butylamino)-5-(4-oxocyclohexyl)-8-piperazin-1-ylpyrimido[4,5-c]isoquinolin-6-one (CID 134163812) is 3-(butylamino)-5-(4-oxocyclohexyl)-8-piperazin-1-ylpyrimido[4,5-c]isoquinolin-6-one.
What is the SMILES notation for 3-(butylamino)-5-(4-oxocyclohexyl)-8-piperazin-1-ylpyrimido[4,5-c]isoquinolin-6-one?
The canonical SMILES for 3-(butylamino)-5-(4-oxocyclohexyl)-8-piperazin-1-ylpyrimido[4,5-c]isoquinolin-6-one is CCCCNc1ncc2c3ccc(N4CCNCC4)cc3c(=O)n(C3CCC(=O)CC3)c2n1.
What is the InChIKey of 3-(butylamino)-5-(4-oxocyclohexyl)-8-piperazin-1-ylpyrimido[4,5-c]isoquinolin-6-one?
The InChIKey is ZHDSEZKUKCXQEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32N6O2/c1-2-3-10-27-25-28-16-22-20-9-6-18(30-13-11-26-12-14-30)15-21(20)24(33)31(23(22)29-25)17-4-7-19(32)8-5-17/h6,9,15-17,26H,2-5,7-8,10-14H2,1H3,(H,27,28,29).
What are the key properties of 3-(butylamino)-5-(4-oxocyclohexyl)-8-piperazin-1-ylpyrimido[4,5-c]isoquinolin-6-one?
3-(butylamino)-5-(4-oxocyclohexyl)-8-piperazin-1-ylpyrimido[4,5-c]isoquinolin-6-one has a molecular weight of 448.57 g/mol, XLogP of 3.25, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(butylamino)-5-(4-oxocyclohexyl)-8-piperazin-1-ylpyrimido[4,5-c]isoquinolin-6-one is sourced from PubChem (CID 134163812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).