C26H33N5O2S — CID 134163831
3-(cyclopropylmethylamino)-5-(4-hydroxycyclohexyl)-8-(thiomorpholin-4-ylmethyl)pyrimido[4,5-c]isoquinolin-6-one (PubChem CID 134163831) has the molecular formula C26H33N5O2S and a molecular weight of 479.65 g/mol. Its IUPAC name is 3-(cyclopropylmethylamino)-5-(4-hydroxycyclohexyl)-8-(thiomorpholin-4-ylmethyl)pyrimido[4,5-c]isoquinolin-6-one.
| Compound Name | 3-(cyclopropylmethylamino)-5-(4-hydroxycyclohexyl)-8-(thiomorpholin-4-ylmethyl)pyrimido[4,5-c]isoquinolin-6-one |
|---|---|
| PubChem CID | 134163831 |
| Molecular Formula | C26H33N5O2S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 3-(cyclopropylmethylamino)-5-(4-hydroxycyclohexyl)-8-(thiomorpholin-4-ylmethyl)pyrimido[4,5-c]isoquinolin-6-one |
| SMILES | O=c1c2cc(CN3CCSCC3)ccc2c2cnc(NCC3CC3)nc2n1C1CCC(O)CC1 |
| InChI | InChI=1S/C26H33N5O2S/c32-20-6-4-19(5-7-20)31-24-23(15-28-26(29-24)27-14-17-1-2-17)21-8-3-18(13-22(21)25(31)33)16-30-9-11-34-12-10-30/h3,8,13,15,17,19-20,32H,1-2,4-7,9-12,14,16H2,(H,27,28,29) |
| InChIKey | YVLFDNYBLRRNAP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|