C29H29FN6O3 — CID 134164210
4-amino-6-[5-[(2-fluoro-3-pyridinyl)oxy]pent-1-ynyl]-N-[4-(methoxymethyl)phenyl]-7-(1-methylcyclopropyl)pyrrolo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 134164210) has the molecular formula C29H29FN6O3 and a molecular weight of 528.59 g/mol. Its IUPAC name is 4-amino-6-[5-[(2-fluoro-3-pyridinyl)oxy]pent-1-ynyl]-N-[4-(methoxymethyl)phenyl]-7-(1-methylcyclopropyl)pyrrolo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 4-amino-6-[5-[(2-fluoro-3-pyridinyl)oxy]pent-1-ynyl]-N-[4-(methoxymethyl)phenyl]-7-(1-methylcyclopropyl)pyrrolo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 134164210 |
| Molecular Formula | C29H29FN6O3 |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 4-amino-6-[5-[(2-fluoro-3-pyridinyl)oxy]pent-1-ynyl]-N-[4-(methoxymethyl)phenyl]-7-(1-methylcyclopropyl)pyrrolo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | COCc1ccc(NC(=O)c2c(C#CCCCOc3cccnc3F)n(C3(C)CC3)c3ncnc(N)c23)cc1 |
| InChI | InChI=1S/C29H29FN6O3/c1-29(13-14-29)36-21(7-4-3-5-16-39-22-8-6-15-32-25(22)30)23(24-26(31)33-18-34-27(24)36)28(37)35-20-11-9-19(10-12-20)17-38-2/h6,8-12,15,18H,3,5,13-14,16-17H2,1-2H3,(H,35,37)(H2,31,33,34) |
| InChIKey | SBBQZOAFRSQZJD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|