C24H22F3N5O3 — CID 134164654
4-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-2-[3-(trifluoromethoxy)phenyl]quinoline-7-carboxamide (PubChem CID 134164654) has the molecular formula C24H22F3N5O3 and a molecular weight of 485.47 g/mol. Its IUPAC name is 4-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-2-[3-(trifluoromethoxy)phenyl]quinoline-7-carboxamide.
| Compound Name | 4-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-2-[3-(trifluoromethoxy)phenyl]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 134164654 |
| Molecular Formula | C24H22F3N5O3 |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 4-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-2-[3-(trifluoromethoxy)phenyl]quinoline-7-carboxamide |
| SMILES | CCOc1cc(-c2cccc(OC(F)(F)F)c2)nc2cc(C(=O)NCCCc3ncn[nH]3)ccc12 |
| InChI | InChI=1S/C24H22F3N5O3/c1-2-34-21-13-19(15-5-3-6-17(11-15)35-24(25,26)27)31-20-12-16(8-9-18(20)21)23(33)28-10-4-7-22-29-14-30-32-22/h3,5-6,8-9,11-14H,2,4,7,10H2,1H3,(H,28,33)(H,29,30,32) |
| InChIKey | GNBRCNYCHYONEU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|