C18H16BrClO3 — CID 134164985
4-[[(1S)-4-bromo-2,3-dihydro-1H-inden-1-yl]oxy]-5-chloro-2-ethoxybenzaldehyde (PubChem CID 134164985) has the molecular formula C18H16BrClO3 and a molecular weight of 395.68 g/mol. Its IUPAC name is 4-[[(1S)-4-bromo-2,3-dihydro-1H-inden-1-yl]oxy]-5-chloro-2-ethoxybenzaldehyde.
| Compound Name | 4-[[(1S)-4-bromo-2,3-dihydro-1H-inden-1-yl]oxy]-5-chloro-2-ethoxybenzaldehyde |
|---|---|
| PubChem CID | 134164985 |
| Molecular Formula | C18H16BrClO3 |
| Molecular Weight | 395.68 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | 4-[[(1S)-4-bromo-2,3-dihydro-1H-inden-1-yl]oxy]-5-chloro-2-ethoxybenzaldehyde |
| SMILES | CCOc1cc(O[C@H]2CCc3c(Br)cccc32)c(Cl)cc1C=O |
| InChI | InChI=1S/C18H16BrClO3/c1-2-22-17-9-18(15(20)8-11(17)10-21)23-16-7-6-12-13(16)4-3-5-14(12)19/h3-5,8-10,16H,2,6-7H2,1H3/t16-/m0/s1 |
| InChIKey | ILFQCLAIWIDRPN-INIZCTEOSA-N |
| XLogP | 5.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.68 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|