C9H13ClO2 — CID 13416553
5-[(Z)-1-chloroprop-1-enyl]-3,3-dimethyloxolan-2-one (PubChem CID 13416553) has the molecular formula C9H13ClO2 and a molecular weight of 188.65 g/mol. Its IUPAC name is 5-[(Z)-1-chloroprop-1-enyl]-3,3-dimethyloxolan-2-one.
| Compound Name | 5-[(Z)-1-chloroprop-1-enyl]-3,3-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 13416553 |
| Molecular Formula | C9H13ClO2 |
| Molecular Weight | 188.65 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 5-[(Z)-1-chloroprop-1-enyl]-3,3-dimethyloxolan-2-one |
| SMILES | C/C=C(\Cl)C1CC(C)(C)C(=O)O1 |
| InChI | InChI=1S/C9H13ClO2/c1-4-6(10)7-5-9(2,3)8(11)12-7/h4,7H,5H2,1-3H3/b6-4- |
| InChIKey | ZVPZEPFTEPVKBH-XQRVVYSFSA-N |
| XLogP | 2.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.65 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |