C11H7F9O — CID 134166081
[3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]methanol (PubChem CID 134166081) has the molecular formula C11H7F9O and a molecular weight of 326.16 g/mol. Its IUPAC name is [3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]methanol.
| Compound Name | [3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]methanol |
|---|---|
| PubChem CID | 134166081 |
| Molecular Formula | C11H7F9O |
| Molecular Weight | 326.16 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | [3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]methanol |
| SMILES | OCc1cccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H7F9O/c12-8(13,7-3-1-2-6(4-7)5-21)9(14,15)10(16,17)11(18,19)20/h1-4,21H,5H2 |
| InChIKey | KQCSPDKWMPSJBV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.16 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|