About (Z)-1-[5-(2,2-difluoropropoxy)-2-pyridinyl]-2-ethylsulfonylethenamine
(Z)-1-[5-(2,2-difluoropropoxy)-2-pyridinyl]-2-ethylsulfonylethenamine (PubChem CID 134166753) has the molecular formula C12H16F2N2O3S
and a molecular weight of 306.33 g/mol. Its IUPAC name is (Z)-1-[5-(2,2-difluoropropoxy)-2-pyridinyl]-2-ethylsulfonylethenamine.
Molecular Properties
| Compound Name | (Z)-1-[5-(2,2-difluoropropoxy)-2-pyridinyl]-2-ethylsulfonylethenamine |
| PubChem CID | 134166753 |
| Molecular Formula | C12H16F2N2O3S |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | (Z)-1-[5-(2,2-difluoropropoxy)-2-pyridinyl]-2-ethylsulfonylethenamine |
| SMILES | CCS(=O)(=O)/C=C(\N)c1ccc(OCC(C)(F)F)cn1 |
| InChI | InChI=1S/C12H16F2N2O3S/c1-3-20(17,18)7-10(15)11-5-4-9(6-16-11)19-8-12(2,13)14/h4-7H,3,8,15H2,1-2H3/b10-7- |
| InChIKey | YOHBVRSZFDYJFR-YFHOEESVSA-N |
| XLogP | 1.81 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (Z)-1-[5-(2,2-difluoropropoxy)-2-pyridinyl]-2-ethylsulfonylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-[5-(2,2-difluoropropoxy)-2-pyridinyl]-2-ethylsulfonylethenamine?
The IUPAC name of (Z)-1-[5-(2,2-difluoropropoxy)-2-pyridinyl]-2-ethylsulfonylethenamine (CID 134166753) is (Z)-1-[5-(2,2-difluoropropoxy)-2-pyridinyl]-2-ethylsulfonylethenamine.
What is the SMILES notation for (Z)-1-[5-(2,2-difluoropropoxy)-2-pyridinyl]-2-ethylsulfonylethenamine?
The canonical SMILES for (Z)-1-[5-(2,2-difluoropropoxy)-2-pyridinyl]-2-ethylsulfonylethenamine is CCS(=O)(=O)/C=C(\N)c1ccc(OCC(C)(F)F)cn1.
What is the InChIKey of (Z)-1-[5-(2,2-difluoropropoxy)-2-pyridinyl]-2-ethylsulfonylethenamine?
The InChIKey is YOHBVRSZFDYJFR-YFHOEESVSA-N. The full InChI is InChI=1S/C12H16F2N2O3S/c1-3-20(17,18)7-10(15)11-5-4-9(6-16-11)19-8-12(2,13)14/h4-7H,3,8,15H2,1-2H3/b10-7-.
What are the key properties of (Z)-1-[5-(2,2-difluoropropoxy)-2-pyridinyl]-2-ethylsulfonylethenamine?
(Z)-1-[5-(2,2-difluoropropoxy)-2-pyridinyl]-2-ethylsulfonylethenamine has a molecular weight of 306.33 g/mol, XLogP of 1.81, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-[5-(2,2-difluoropropoxy)-2-pyridinyl]-2-ethylsulfonylethenamine is sourced from PubChem (CID 134166753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).