About 3-(2,2-dimethyl-1,3-dioxolan-4-yl)propan-1-amine
3-(2,2-dimethyl-1,3-dioxolan-4-yl)propan-1-amine (PubChem CID 13416686) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is 3-(2,2-dimethyl-1,3-dioxolan-4-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(2,2-dimethyl-1,3-dioxolan-4-yl)propan-1-amine |
| PubChem CID | 13416686 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 3-(2,2-dimethyl-1,3-dioxolan-4-yl)propan-1-amine |
| SMILES | CC1(C)OCC(CCCN)O1 |
| InChI | InChI=1S/C8H17NO2/c1-8(2)10-6-7(11-8)4-3-5-9/h7H,3-6,9H2,1-2H3 |
| InChIKey | GBBSNHIEYJAWAP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,2-dimethyl-1,3-dioxolan-4-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dimethyl-1,3-dioxolan-4-yl)propan-1-amine?
The IUPAC name of 3-(2,2-dimethyl-1,3-dioxolan-4-yl)propan-1-amine (CID 13416686) is 3-(2,2-dimethyl-1,3-dioxolan-4-yl)propan-1-amine.
What is the SMILES notation for 3-(2,2-dimethyl-1,3-dioxolan-4-yl)propan-1-amine?
The canonical SMILES for 3-(2,2-dimethyl-1,3-dioxolan-4-yl)propan-1-amine is CC1(C)OCC(CCCN)O1.
What is the InChIKey of 3-(2,2-dimethyl-1,3-dioxolan-4-yl)propan-1-amine?
The InChIKey is GBBSNHIEYJAWAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2/c1-8(2)10-6-7(11-8)4-3-5-9/h7H,3-6,9H2,1-2H3.
What are the key properties of 3-(2,2-dimethyl-1,3-dioxolan-4-yl)propan-1-amine?
3-(2,2-dimethyl-1,3-dioxolan-4-yl)propan-1-amine has a molecular weight of 159.23 g/mol, XLogP of 0.88, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethyl-1,3-dioxolan-4-yl)propan-1-amine is sourced from PubChem (CID 13416686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).