C19H19N7O — CID 134167114
4-(12-methyl-9-oxa-2,3,13-triazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-6-yl)-N-(2-methylpyrazol-3-yl)pyridin-2-amine (PubChem CID 134167114) has the molecular formula C19H19N7O and a molecular weight of 361.41 g/mol. Its IUPAC name is 4-(12-methyl-9-oxa-2,3,13-triazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-6-yl)-N-(2-methylpyrazol-3-yl)pyridin-2-amine.
| Compound Name | 4-(12-methyl-9-oxa-2,3,13-triazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-6-yl)-N-(2-methylpyrazol-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 134167114 |
| Molecular Formula | C19H19N7O |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 4-(12-methyl-9-oxa-2,3,13-triazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-6-yl)-N-(2-methylpyrazol-3-yl)pyridin-2-amine |
| SMILES | CC1CCOc2cc(-c3ccnc(Nc4ccnn4C)c3)cc3nnc1n23 |
| InChI | InChI=1S/C19H19N7O/c1-12-5-8-27-18-11-14(10-17-23-24-19(12)26(17)18)13-3-6-20-15(9-13)22-16-4-7-21-25(16)2/h3-4,6-7,9-12H,5,8H2,1-2H3,(H,20,22) |
| InChIKey | YDNNBFNGDSGYFC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |