C49H29N5 — CID 134167395
2-[4-(2,6-dipyridin-3-yl-4-pyridinyl)phenyl]-9-fluoranthen-3-yl-1,10-phenanthroline (PubChem CID 134167395) has the molecular formula C49H29N5 and a molecular weight of 687.81 g/mol. Its IUPAC name is 2-[4-(2,6-dipyridin-3-yl-4-pyridinyl)phenyl]-9-fluoranthen-3-yl-1,10-phenanthroline.
| Compound Name | 2-[4-(2,6-dipyridin-3-yl-4-pyridinyl)phenyl]-9-fluoranthen-3-yl-1,10-phenanthroline |
|---|---|
| PubChem CID | 134167395 |
| Molecular Formula | C49H29N5 |
| Molecular Weight | 687.81 g/mol |
| Exact Mass | 687.24 |
| IUPAC Name | 2-[4-(2,6-dipyridin-3-yl-4-pyridinyl)phenyl]-9-fluoranthen-3-yl-1,10-phenanthroline |
| SMILES | c1cncc(-c2cc(-c3ccc(-c4ccc5ccc6ccc(-c7ccc8c9c(cccc79)-c7ccccc7-8)nc6c5n4)cc3)cc(-c3cccnc3)n2)c1 |
| InChI | InChI=1S/C49H29N5/c1-2-9-38-37(8-1)40-10-3-11-41-39(20-21-42(38)47(40)41)44-23-19-33-17-16-32-18-22-43(53-48(32)49(33)54-44)31-14-12-30(13-15-31)36-26-45(34-6-4-24-50-28-34)52-46(27-36)35-7-5-25-51-29-35/h1-29H |
| InChIKey | VWBPBJDGRMUZCX-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.81 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|