C64H43N5 — CID 134167701
2-[3-(9,9-dimethylfluoren-2-yl)phenyl]-9-[4-[4-phenyl-2-(3-pyridin-3-ylphenyl)quinazolin-6-yl]phenyl]-1,10-phenanthroline (PubChem CID 134167701) has the molecular formula C64H43N5 and a molecular weight of 882.08 g/mol. Its IUPAC name is 2-[3-(9,9-dimethylfluoren-2-yl)phenyl]-9-[4-[4-phenyl-2-(3-pyridin-3-ylphenyl)quinazolin-6-yl]phenyl]-1,10-phenanthroline.
| Compound Name | 2-[3-(9,9-dimethylfluoren-2-yl)phenyl]-9-[4-[4-phenyl-2-(3-pyridin-3-ylphenyl)quinazolin-6-yl]phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 134167701 |
| Molecular Formula | C64H43N5 |
| Molecular Weight | 882.08 g/mol |
| Exact Mass | 881.35 |
| IUPAC Name | 2-[3-(9,9-dimethylfluoren-2-yl)phenyl]-9-[4-[4-phenyl-2-(3-pyridin-3-ylphenyl)quinazolin-6-yl]phenyl]-1,10-phenanthroline |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3cccc(-c4ccc5ccc6ccc(-c7ccc(-c8ccc9nc(-c%10cccc(-c%11cccnc%11)c%10)nc(-c%10ccccc%10)c9c8)cc7)nc6c5n4)c3)cc21 |
| InChI | InChI=1S/C64H43N5/c1-64(2)55-19-7-6-18-52(55)53-30-26-48(38-56(53)64)45-13-8-15-49(35-45)58-32-28-44-25-24-43-27-31-57(66-61(43)62(44)67-58)41-22-20-40(21-23-41)47-29-33-59-54(37-47)60(42-11-4-3-5-12-42)69-63(68-59)50-16-9-14-46(36-50)51-17-10-34-65-39-51/h3-39H,1-2H3 |
| InChIKey | NDGNLSFRQUXFHB-UHFFFAOYSA-N |
| XLogP | 16.10 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.08 |
| LogP ≤ 5 | 16.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|