C28H25F4N5O2 — CID 134168307
1-[2-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-4,6-difluorophenyl]-3-methoxyurea (PubChem CID 134168307) has the molecular formula C28H25F4N5O2 and a molecular weight of 539.53 g/mol. Its IUPAC name is 1-[2-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-4,6-difluorophenyl]-3-methoxyurea.
| Compound Name | 1-[2-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-4,6-difluorophenyl]-3-methoxyurea |
|---|---|
| PubChem CID | 134168307 |
| Molecular Formula | C28H25F4N5O2 |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | 1-[2-[4-(4-aminopiperidin-1-yl)-3-(3,5-difluorophenyl)quinolin-6-yl]-4,6-difluorophenyl]-3-methoxyurea |
| SMILES | CONC(=O)Nc1c(F)cc(F)cc1-c1ccc2ncc(-c3cc(F)cc(F)c3)c(N3CCC(N)CC3)c2c1 |
| InChI | InChI=1S/C28H25F4N5O2/c1-39-36-28(38)35-26-21(12-19(31)13-24(26)32)15-2-3-25-22(10-15)27(37-6-4-20(33)5-7-37)23(14-34-25)16-8-17(29)11-18(30)9-16/h2-3,8-14,20H,4-7,33H2,1H3,(H2,35,36,38) |
| InChIKey | IOLPVDHOVAVWTN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|