C27H24F2N4O2 — CID 134168327
3-[4-[(4aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-1H-pyridin-2-one (PubChem CID 134168327) has the molecular formula C27H24F2N4O2 and a molecular weight of 474.51 g/mol. Its IUPAC name is 3-[4-[(4aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-1H-pyridin-2-one.
| Compound Name | 3-[4-[(4aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 134168327 |
| Molecular Formula | C27H24F2N4O2 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 3-[4-[(4aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]-1H-pyridin-2-one |
| SMILES | O=c1[nH]cccc1-c1ccc2ncc(-c3cc(F)cc(F)c3)c(N3CCC4NCCO[C@@H]4C3)c2c1 |
| InChI | InChI=1S/C27H24F2N4O2/c28-18-10-17(11-19(29)13-18)22-14-32-23-4-3-16(20-2-1-6-31-27(20)34)12-21(23)26(22)33-8-5-24-25(15-33)35-9-7-30-24/h1-4,6,10-14,24-25,30H,5,7-9,15H2,(H,31,34)/t24?,25-/m1/s1 |
| InChIKey | BSPJRLIOYFWPNV-WUBHUQEYSA-N |
| XLogP | 4.10 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |