C16H27F3N2O2 — CID 134168414
N-[6-(4-ethyl-4-methylpiperidin-1-yl)-6-oxohexyl]-2,2,2-trifluoroacetamide (PubChem CID 134168414) has the molecular formula C16H27F3N2O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is N-[6-(4-ethyl-4-methylpiperidin-1-yl)-6-oxohexyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[6-(4-ethyl-4-methylpiperidin-1-yl)-6-oxohexyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 134168414 |
| Molecular Formula | C16H27F3N2O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-[6-(4-ethyl-4-methylpiperidin-1-yl)-6-oxohexyl]-2,2,2-trifluoroacetamide |
| SMILES | CCC1(C)CCN(C(=O)CCCCCNC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H27F3N2O2/c1-3-15(2)8-11-21(12-9-15)13(22)7-5-4-6-10-20-14(23)16(17,18)19/h3-12H2,1-2H3,(H,20,23) |
| InChIKey | UQXSMICTDCMISU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|