C9H15FN2O — CID 134169328
1-[(1R,2R)-2-fluorocyclohexyl]imidazolidin-2-one (PubChem CID 134169328) has the molecular formula C9H15FN2O and a molecular weight of 186.23 g/mol. Its IUPAC name is 1-[(1R,2R)-2-fluorocyclohexyl]imidazolidin-2-one.
| Compound Name | 1-[(1R,2R)-2-fluorocyclohexyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 134169328 |
| Molecular Formula | C9H15FN2O |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1-[(1R,2R)-2-fluorocyclohexyl]imidazolidin-2-one |
| SMILES | O=C1NCCN1[C@@H]1CCCC[C@H]1F |
| InChI | InChI=1S/C9H15FN2O/c10-7-3-1-2-4-8(7)12-6-5-11-9(12)13/h7-8H,1-6H2,(H,11,13)/t7-,8-/m1/s1 |
| InChIKey | GYMBEMXWCZWVKN-HTQZYQBOSA-N |
| XLogP | 1.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |