About (5R)-2-amino-5-[(1S)-1-hydroxyethyl]-2-methyloxolane-3,4-diol
(5R)-2-amino-5-[(1S)-1-hydroxyethyl]-2-methyloxolane-3,4-diol (PubChem CID 134169455) has the molecular formula C7H15NO4
and a molecular weight of 177.20 g/mol. Its IUPAC name is (5R)-2-amino-5-[(1S)-1-hydroxyethyl]-2-methyloxolane-3,4-diol.
Molecular Properties
| Compound Name | (5R)-2-amino-5-[(1S)-1-hydroxyethyl]-2-methyloxolane-3,4-diol |
| PubChem CID | 134169455 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | (5R)-2-amino-5-[(1S)-1-hydroxyethyl]-2-methyloxolane-3,4-diol |
| SMILES | C[C@H](O)[C@H]1OC(C)(N)C(O)C1O |
| InChI | InChI=1S/C7H15NO4/c1-3(9)5-4(10)6(11)7(2,8)12-5/h3-6,9-11H,8H2,1-2H3/t3-,4?,5+,6?,7?/m0/s1 |
| InChIKey | NUWKUGGJXBHDQV-UNEZJIQRSA-N |
| XLogP | -1.84 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5R)-2-amino-5-[(1S)-1-hydroxyethyl]-2-methyloxolane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-2-amino-5-[(1S)-1-hydroxyethyl]-2-methyloxolane-3,4-diol?
The IUPAC name of (5R)-2-amino-5-[(1S)-1-hydroxyethyl]-2-methyloxolane-3,4-diol (CID 134169455) is (5R)-2-amino-5-[(1S)-1-hydroxyethyl]-2-methyloxolane-3,4-diol.
What is the SMILES notation for (5R)-2-amino-5-[(1S)-1-hydroxyethyl]-2-methyloxolane-3,4-diol?
The canonical SMILES for (5R)-2-amino-5-[(1S)-1-hydroxyethyl]-2-methyloxolane-3,4-diol is C[C@H](O)[C@H]1OC(C)(N)C(O)C1O.
What is the InChIKey of (5R)-2-amino-5-[(1S)-1-hydroxyethyl]-2-methyloxolane-3,4-diol?
The InChIKey is NUWKUGGJXBHDQV-UNEZJIQRSA-N. The full InChI is InChI=1S/C7H15NO4/c1-3(9)5-4(10)6(11)7(2,8)12-5/h3-6,9-11H,8H2,1-2H3/t3-,4?,5+,6?,7?/m0/s1.
What are the key properties of (5R)-2-amino-5-[(1S)-1-hydroxyethyl]-2-methyloxolane-3,4-diol?
(5R)-2-amino-5-[(1S)-1-hydroxyethyl]-2-methyloxolane-3,4-diol has a molecular weight of 177.20 g/mol, XLogP of -1.84, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-2-amino-5-[(1S)-1-hydroxyethyl]-2-methyloxolane-3,4-diol is sourced from PubChem (CID 134169455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).