About [3-ethenyl-1,4,4-trimethyl-2-[(Z)-prop-1-enyl]cyclopent-2-en-1-yl] 2-methylprop-2-enoate
[3-ethenyl-1,4,4-trimethyl-2-[(Z)-prop-1-enyl]cyclopent-2-en-1-yl] 2-methylprop-2-enoate (PubChem CID 134170354) has the molecular formula C17H24O2
and a molecular weight of 260.38 g/mol. Its IUPAC name is [3-ethenyl-1,4,4-trimethyl-2-[(Z)-prop-1-enyl]cyclopent-2-en-1-yl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [3-ethenyl-1,4,4-trimethyl-2-[(Z)-prop-1-enyl]cyclopent-2-en-1-yl] 2-methylprop-2-enoate |
| PubChem CID | 134170354 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | [3-ethenyl-1,4,4-trimethyl-2-[(Z)-prop-1-enyl]cyclopent-2-en-1-yl] 2-methylprop-2-enoate |
| SMILES | C=CC1=C(/C=C\C)C(C)(OC(=O)C(=C)C)CC1(C)C |
| InChI | InChI=1S/C17H24O2/c1-8-10-14-13(9-2)16(5,6)11-17(14,7)19-15(18)12(3)4/h8-10H,2-3,11H2,1,4-7H3/b10-8- |
| InChIKey | ORGUDOBIKGGJCT-NTMALXAHSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [3-ethenyl-1,4,4-trimethyl-2-[(Z)-prop-1-enyl]cyclopent-2-en-1-yl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-ethenyl-1,4,4-trimethyl-2-[(Z)-prop-1-enyl]cyclopent-2-en-1-yl] 2-methylprop-2-enoate?
The IUPAC name of [3-ethenyl-1,4,4-trimethyl-2-[(Z)-prop-1-enyl]cyclopent-2-en-1-yl] 2-methylprop-2-enoate (CID 134170354) is [3-ethenyl-1,4,4-trimethyl-2-[(Z)-prop-1-enyl]cyclopent-2-en-1-yl] 2-methylprop-2-enoate.
What is the SMILES notation for [3-ethenyl-1,4,4-trimethyl-2-[(Z)-prop-1-enyl]cyclopent-2-en-1-yl] 2-methylprop-2-enoate?
The canonical SMILES for [3-ethenyl-1,4,4-trimethyl-2-[(Z)-prop-1-enyl]cyclopent-2-en-1-yl] 2-methylprop-2-enoate is C=CC1=C(/C=C\C)C(C)(OC(=O)C(=C)C)CC1(C)C.
What is the InChIKey of [3-ethenyl-1,4,4-trimethyl-2-[(Z)-prop-1-enyl]cyclopent-2-en-1-yl] 2-methylprop-2-enoate?
The InChIKey is ORGUDOBIKGGJCT-NTMALXAHSA-N. The full InChI is InChI=1S/C17H24O2/c1-8-10-14-13(9-2)16(5,6)11-17(14,7)19-15(18)12(3)4/h8-10H,2-3,11H2,1,4-7H3/b10-8-.
What are the key properties of [3-ethenyl-1,4,4-trimethyl-2-[(Z)-prop-1-enyl]cyclopent-2-en-1-yl] 2-methylprop-2-enoate?
[3-ethenyl-1,4,4-trimethyl-2-[(Z)-prop-1-enyl]cyclopent-2-en-1-yl] 2-methylprop-2-enoate has a molecular weight of 260.38 g/mol, XLogP of 4.35, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-ethenyl-1,4,4-trimethyl-2-[(Z)-prop-1-enyl]cyclopent-2-en-1-yl] 2-methylprop-2-enoate is sourced from PubChem (CID 134170354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).