About (2R,5R)-5-(2,2-dimethylpropyl)-1-methyl-2-(trifluoromethyl)piperidine
(2R,5R)-5-(2,2-dimethylpropyl)-1-methyl-2-(trifluoromethyl)piperidine (PubChem CID 134170710) has the molecular formula C12H22F3N
and a molecular weight of 237.31 g/mol. Its IUPAC name is (2R,5R)-5-(2,2-dimethylpropyl)-1-methyl-2-(trifluoromethyl)piperidine.
Molecular Properties
| Compound Name | (2R,5R)-5-(2,2-dimethylpropyl)-1-methyl-2-(trifluoromethyl)piperidine |
| PubChem CID | 134170710 |
| Molecular Formula | C12H22F3N |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | (2R,5R)-5-(2,2-dimethylpropyl)-1-methyl-2-(trifluoromethyl)piperidine |
| SMILES | CN1C[C@@H](CC(C)(C)C)CC[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C12H22F3N/c1-11(2,3)7-9-5-6-10(12(13,14)15)16(4)8-9/h9-10H,5-8H2,1-4H3/t9-,10-/m1/s1 |
| InChIKey | GIHFJEPEBDNDLY-NXEZZACHSA-N |
| XLogP | 3.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R,5R)-5-(2,2-dimethylpropyl)-1-methyl-2-(trifluoromethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-5-(2,2-dimethylpropyl)-1-methyl-2-(trifluoromethyl)piperidine?
The IUPAC name of (2R,5R)-5-(2,2-dimethylpropyl)-1-methyl-2-(trifluoromethyl)piperidine (CID 134170710) is (2R,5R)-5-(2,2-dimethylpropyl)-1-methyl-2-(trifluoromethyl)piperidine.
What is the SMILES notation for (2R,5R)-5-(2,2-dimethylpropyl)-1-methyl-2-(trifluoromethyl)piperidine?
The canonical SMILES for (2R,5R)-5-(2,2-dimethylpropyl)-1-methyl-2-(trifluoromethyl)piperidine is CN1C[C@@H](CC(C)(C)C)CC[C@@H]1C(F)(F)F.
What is the InChIKey of (2R,5R)-5-(2,2-dimethylpropyl)-1-methyl-2-(trifluoromethyl)piperidine?
The InChIKey is GIHFJEPEBDNDLY-NXEZZACHSA-N. The full InChI is InChI=1S/C12H22F3N/c1-11(2,3)7-9-5-6-10(12(13,14)15)16(4)8-9/h9-10H,5-8H2,1-4H3/t9-,10-/m1/s1.
What are the key properties of (2R,5R)-5-(2,2-dimethylpropyl)-1-methyl-2-(trifluoromethyl)piperidine?
(2R,5R)-5-(2,2-dimethylpropyl)-1-methyl-2-(trifluoromethyl)piperidine has a molecular weight of 237.31 g/mol, XLogP of 3.70, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-5-(2,2-dimethylpropyl)-1-methyl-2-(trifluoromethyl)piperidine is sourced from PubChem (CID 134170710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).