About (2R,5R)-5-(2,2-dimethylpentyl)-1-methyl-2-(trifluoromethyl)piperidine
(2R,5R)-5-(2,2-dimethylpentyl)-1-methyl-2-(trifluoromethyl)piperidine (PubChem CID 134170711) has the molecular formula C14H26F3N
and a molecular weight of 265.36 g/mol. Its IUPAC name is (2R,5R)-5-(2,2-dimethylpentyl)-1-methyl-2-(trifluoromethyl)piperidine.
Molecular Properties
| Compound Name | (2R,5R)-5-(2,2-dimethylpentyl)-1-methyl-2-(trifluoromethyl)piperidine |
| PubChem CID | 134170711 |
| Molecular Formula | C14H26F3N |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | (2R,5R)-5-(2,2-dimethylpentyl)-1-methyl-2-(trifluoromethyl)piperidine |
| SMILES | CCCC(C)(C)C[C@H]1CC[C@H](C(F)(F)F)N(C)C1 |
| InChI | InChI=1S/C14H26F3N/c1-5-8-13(2,3)9-11-6-7-12(14(15,16)17)18(4)10-11/h11-12H,5-10H2,1-4H3/t11-,12-/m1/s1 |
| InChIKey | VWTCJEHXAVLESI-VXGBXAGGSA-N |
| XLogP | 4.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R,5R)-5-(2,2-dimethylpentyl)-1-methyl-2-(trifluoromethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-5-(2,2-dimethylpentyl)-1-methyl-2-(trifluoromethyl)piperidine?
The IUPAC name of (2R,5R)-5-(2,2-dimethylpentyl)-1-methyl-2-(trifluoromethyl)piperidine (CID 134170711) is (2R,5R)-5-(2,2-dimethylpentyl)-1-methyl-2-(trifluoromethyl)piperidine.
What is the SMILES notation for (2R,5R)-5-(2,2-dimethylpentyl)-1-methyl-2-(trifluoromethyl)piperidine?
The canonical SMILES for (2R,5R)-5-(2,2-dimethylpentyl)-1-methyl-2-(trifluoromethyl)piperidine is CCCC(C)(C)C[C@H]1CC[C@H](C(F)(F)F)N(C)C1.
What is the InChIKey of (2R,5R)-5-(2,2-dimethylpentyl)-1-methyl-2-(trifluoromethyl)piperidine?
The InChIKey is VWTCJEHXAVLESI-VXGBXAGGSA-N. The full InChI is InChI=1S/C14H26F3N/c1-5-8-13(2,3)9-11-6-7-12(14(15,16)17)18(4)10-11/h11-12H,5-10H2,1-4H3/t11-,12-/m1/s1.
What are the key properties of (2R,5R)-5-(2,2-dimethylpentyl)-1-methyl-2-(trifluoromethyl)piperidine?
(2R,5R)-5-(2,2-dimethylpentyl)-1-methyl-2-(trifluoromethyl)piperidine has a molecular weight of 265.36 g/mol, XLogP of 4.48, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-5-(2,2-dimethylpentyl)-1-methyl-2-(trifluoromethyl)piperidine is sourced from PubChem (CID 134170711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).