About 3-[6-(1H-indol-2-yl)indolizin-2-yl]-1,8-naphthyridine
3-[6-(1H-indol-2-yl)indolizin-2-yl]-1,8-naphthyridine (PubChem CID 134171104) has the molecular formula C24H16N4
and a molecular weight of 360.42 g/mol. Its IUPAC name is 3-[6-(1H-indol-2-yl)indolizin-2-yl]-1,8-naphthyridine.
Molecular Properties
| Compound Name | 3-[6-(1H-indol-2-yl)indolizin-2-yl]-1,8-naphthyridine |
| PubChem CID | 134171104 |
| Molecular Formula | C24H16N4 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 3-[6-(1H-indol-2-yl)indolizin-2-yl]-1,8-naphthyridine |
| SMILES | c1cnc2ncc(-c3cc4ccc(-c5cc6ccccc6[nH]5)cn4c3)cc2c1 |
| InChI | InChI=1S/C24H16N4/c1-2-6-22-16(4-1)12-23(27-22)18-7-8-21-11-20(15-28(21)14-18)19-10-17-5-3-9-25-24(17)26-13-19/h1-15,27H |
| InChIKey | QPSNNYKXMMRMRP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[6-(1H-indol-2-yl)indolizin-2-yl]-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-(1H-indol-2-yl)indolizin-2-yl]-1,8-naphthyridine?
The IUPAC name of 3-[6-(1H-indol-2-yl)indolizin-2-yl]-1,8-naphthyridine (CID 134171104) is 3-[6-(1H-indol-2-yl)indolizin-2-yl]-1,8-naphthyridine.
What is the SMILES notation for 3-[6-(1H-indol-2-yl)indolizin-2-yl]-1,8-naphthyridine?
The canonical SMILES for 3-[6-(1H-indol-2-yl)indolizin-2-yl]-1,8-naphthyridine is c1cnc2ncc(-c3cc4ccc(-c5cc6ccccc6[nH]5)cn4c3)cc2c1.
What is the InChIKey of 3-[6-(1H-indol-2-yl)indolizin-2-yl]-1,8-naphthyridine?
The InChIKey is QPSNNYKXMMRMRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16N4/c1-2-6-22-16(4-1)12-23(27-22)18-7-8-21-11-20(15-28(21)14-18)19-10-17-5-3-9-25-24(17)26-13-19/h1-15,27H.
What are the key properties of 3-[6-(1H-indol-2-yl)indolizin-2-yl]-1,8-naphthyridine?
3-[6-(1H-indol-2-yl)indolizin-2-yl]-1,8-naphthyridine has a molecular weight of 360.42 g/mol, XLogP of 5.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(1H-indol-2-yl)indolizin-2-yl]-1,8-naphthyridine is sourced from PubChem (CID 134171104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).