About 2-(2,6-diiodo-4-methylphenyl)-1,3-diiodo-5-methylbenzene
2-(2,6-diiodo-4-methylphenyl)-1,3-diiodo-5-methylbenzene (PubChem CID 134171342) has the molecular formula C14H10I4
and a molecular weight of 685.85 g/mol. Its IUPAC name is 2-(2,6-diiodo-4-methylphenyl)-1,3-diiodo-5-methylbenzene.
Molecular Properties
| Compound Name | 2-(2,6-diiodo-4-methylphenyl)-1,3-diiodo-5-methylbenzene |
| PubChem CID | 134171342 |
| Molecular Formula | C14H10I4 |
| Molecular Weight | 685.85 g/mol |
| Exact Mass | 685.70 |
| IUPAC Name | 2-(2,6-diiodo-4-methylphenyl)-1,3-diiodo-5-methylbenzene |
| SMILES | Cc1cc(I)c(-c2c(I)cc(C)cc2I)c(I)c1 |
| InChI | InChI=1S/C14H10I4/c1-7-3-9(15)13(10(16)4-7)14-11(17)5-8(2)6-12(14)18/h3-6H,1-2H3 |
| InChIKey | KVUSQXHXJUPCLQ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 685.85 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-diiodo-4-methylphenyl)-1,3-diiodo-5-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-diiodo-4-methylphenyl)-1,3-diiodo-5-methylbenzene?
The IUPAC name of 2-(2,6-diiodo-4-methylphenyl)-1,3-diiodo-5-methylbenzene (CID 134171342) is 2-(2,6-diiodo-4-methylphenyl)-1,3-diiodo-5-methylbenzene.
What is the SMILES notation for 2-(2,6-diiodo-4-methylphenyl)-1,3-diiodo-5-methylbenzene?
The canonical SMILES for 2-(2,6-diiodo-4-methylphenyl)-1,3-diiodo-5-methylbenzene is Cc1cc(I)c(-c2c(I)cc(C)cc2I)c(I)c1.
What is the InChIKey of 2-(2,6-diiodo-4-methylphenyl)-1,3-diiodo-5-methylbenzene?
The InChIKey is KVUSQXHXJUPCLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10I4/c1-7-3-9(15)13(10(16)4-7)14-11(17)5-8(2)6-12(14)18/h3-6H,1-2H3.
What are the key properties of 2-(2,6-diiodo-4-methylphenyl)-1,3-diiodo-5-methylbenzene?
2-(2,6-diiodo-4-methylphenyl)-1,3-diiodo-5-methylbenzene has a molecular weight of 685.85 g/mol, XLogP of 6.39, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-diiodo-4-methylphenyl)-1,3-diiodo-5-methylbenzene is sourced from PubChem (CID 134171342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).