C18H27F3O5 — CID 134171402
[3-ethyl-3-[1-oxo-1-(3,3,3-trifluoropropoxy)propan-2-yl]oxyhex-5-enyl] 2-methylprop-2-enoate (PubChem CID 134171402) has the molecular formula C18H27F3O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is [3-ethyl-3-[1-oxo-1-(3,3,3-trifluoropropoxy)propan-2-yl]oxyhex-5-enyl] 2-methylprop-2-enoate.
| Compound Name | [3-ethyl-3-[1-oxo-1-(3,3,3-trifluoropropoxy)propan-2-yl]oxyhex-5-enyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134171402 |
| Molecular Formula | C18H27F3O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | [3-ethyl-3-[1-oxo-1-(3,3,3-trifluoropropoxy)propan-2-yl]oxyhex-5-enyl] 2-methylprop-2-enoate |
| SMILES | C=CCC(CC)(CCOC(=O)C(=C)C)OC(C)C(=O)OCCC(F)(F)F |
| InChI | InChI=1S/C18H27F3O5/c1-6-8-17(7-2,9-11-24-15(22)13(3)4)26-14(5)16(23)25-12-10-18(19,20)21/h6,14H,1,3,7-12H2,2,4-5H3 |
| InChIKey | USPCOMAGYIOAFV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|