About 5-ethyl-1,4-diazepane-5-carbaldehyde
5-ethyl-1,4-diazepane-5-carbaldehyde (PubChem CID 134171585) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is 5-ethyl-1,4-diazepane-5-carbaldehyde.
Molecular Properties
| Compound Name | 5-ethyl-1,4-diazepane-5-carbaldehyde |
| PubChem CID | 134171585 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 5-ethyl-1,4-diazepane-5-carbaldehyde |
| SMILES | CCC1(C=O)CCNCCN1 |
| InChI | InChI=1S/C8H16N2O/c1-2-8(7-11)3-4-9-5-6-10-8/h7,9-10H,2-6H2,1H3 |
| InChIKey | NBSIZFBYORTPCK-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-1,4-diazepane-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,4-diazepane-5-carbaldehyde?
The IUPAC name of 5-ethyl-1,4-diazepane-5-carbaldehyde (CID 134171585) is 5-ethyl-1,4-diazepane-5-carbaldehyde.
What is the SMILES notation for 5-ethyl-1,4-diazepane-5-carbaldehyde?
The canonical SMILES for 5-ethyl-1,4-diazepane-5-carbaldehyde is CCC1(C=O)CCNCCN1.
What is the InChIKey of 5-ethyl-1,4-diazepane-5-carbaldehyde?
The InChIKey is NBSIZFBYORTPCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-2-8(7-11)3-4-9-5-6-10-8/h7,9-10H,2-6H2,1H3.
What are the key properties of 5-ethyl-1,4-diazepane-5-carbaldehyde?
5-ethyl-1,4-diazepane-5-carbaldehyde has a molecular weight of 156.23 g/mol, XLogP of -0.08, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,4-diazepane-5-carbaldehyde is sourced from PubChem (CID 134171585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).