About 1-[2-methyl-6-(4,4,4-trifluorobutyl)pyrimidin-4-yl]pentan-2-one
1-[2-methyl-6-(4,4,4-trifluorobutyl)pyrimidin-4-yl]pentan-2-one (PubChem CID 134171986) has the molecular formula C14H19F3N2O
and a molecular weight of 288.31 g/mol. Its IUPAC name is 1-[2-methyl-6-(4,4,4-trifluorobutyl)pyrimidin-4-yl]pentan-2-one.
Molecular Properties
| Compound Name | 1-[2-methyl-6-(4,4,4-trifluorobutyl)pyrimidin-4-yl]pentan-2-one |
| PubChem CID | 134171986 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1-[2-methyl-6-(4,4,4-trifluorobutyl)pyrimidin-4-yl]pentan-2-one |
| SMILES | CCCC(=O)Cc1cc(CCCC(F)(F)F)nc(C)n1 |
| InChI | InChI=1S/C14H19F3N2O/c1-3-5-13(20)9-12-8-11(18-10(2)19-12)6-4-7-14(15,16)17/h8H,3-7,9H2,1-2H3 |
| InChIKey | PVXNLNHAOPIDLD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-methyl-6-(4,4,4-trifluorobutyl)pyrimidin-4-yl]pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-methyl-6-(4,4,4-trifluorobutyl)pyrimidin-4-yl]pentan-2-one?
The IUPAC name of 1-[2-methyl-6-(4,4,4-trifluorobutyl)pyrimidin-4-yl]pentan-2-one (CID 134171986) is 1-[2-methyl-6-(4,4,4-trifluorobutyl)pyrimidin-4-yl]pentan-2-one.
What is the SMILES notation for 1-[2-methyl-6-(4,4,4-trifluorobutyl)pyrimidin-4-yl]pentan-2-one?
The canonical SMILES for 1-[2-methyl-6-(4,4,4-trifluorobutyl)pyrimidin-4-yl]pentan-2-one is CCCC(=O)Cc1cc(CCCC(F)(F)F)nc(C)n1.
What is the InChIKey of 1-[2-methyl-6-(4,4,4-trifluorobutyl)pyrimidin-4-yl]pentan-2-one?
The InChIKey is PVXNLNHAOPIDLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F3N2O/c1-3-5-13(20)9-12-8-11(18-10(2)19-12)6-4-7-14(15,16)17/h8H,3-7,9H2,1-2H3.
What are the key properties of 1-[2-methyl-6-(4,4,4-trifluorobutyl)pyrimidin-4-yl]pentan-2-one?
1-[2-methyl-6-(4,4,4-trifluorobutyl)pyrimidin-4-yl]pentan-2-one has a molecular weight of 288.31 g/mol, XLogP of 3.58, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-methyl-6-(4,4,4-trifluorobutyl)pyrimidin-4-yl]pentan-2-one is sourced from PubChem (CID 134171986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).