C11H14F2 — CID 134172117
1-tert-butyl-2,4-difluorocyclohepta-1,3,5-triene (PubChem CID 134172117) has the molecular formula C11H14F2 and a molecular weight of 184.23 g/mol. Its IUPAC name is 1-tert-butyl-2,4-difluorocyclohepta-1,3,5-triene.
| Compound Name | 1-tert-butyl-2,4-difluorocyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 134172117 |
| Molecular Formula | C11H14F2 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 1-tert-butyl-2,4-difluorocyclohepta-1,3,5-triene |
| SMILES | CC(C)(C)C1=C(F)C=C(F)C=CC1 |
| InChI | InChI=1S/C11H14F2/c1-11(2,3)9-6-4-5-8(12)7-10(9)13/h4-5,7H,6H2,1-3H3 |
| InChIKey | PPRBPBYRLBMJTO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |