About [(1R,5R)-5-(hydroxymethyl)-3-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-1-yl]methyl hypoiodite
[(1R,5R)-5-(hydroxymethyl)-3-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-1-yl]methyl hypoiodite (PubChem CID 134172120) has the molecular formula C10H13IO3
and a molecular weight of 308.12 g/mol. Its IUPAC name is [(1R,5R)-5-(hydroxymethyl)-3-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-1-yl]methyl hypoiodite.
Molecular Properties
| Compound Name | [(1R,5R)-5-(hydroxymethyl)-3-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-1-yl]methyl hypoiodite |
| PubChem CID | 134172120 |
| Molecular Formula | C10H13IO3 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | [(1R,5R)-5-(hydroxymethyl)-3-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-1-yl]methyl hypoiodite |
| SMILES | CC1=C[C@@]2(CO)C=C[C@@](COI)(C1)O2 |
| InChI | InChI=1S/C10H13IO3/c1-8-4-9(6-12)2-3-10(5-8,14-9)7-13-11/h2-4,12H,5-7H2,1H3/t9-,10+/m1/s1 |
| InChIKey | KGAPLTSRTUTHAO-ZJUUUORDSA-N |
| XLogP | 1.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,5R)-5-(hydroxymethyl)-3-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-1-yl]methyl hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,5R)-5-(hydroxymethyl)-3-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-1-yl]methyl hypoiodite?
The IUPAC name of [(1R,5R)-5-(hydroxymethyl)-3-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-1-yl]methyl hypoiodite (CID 134172120) is [(1R,5R)-5-(hydroxymethyl)-3-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-1-yl]methyl hypoiodite.
What is the SMILES notation for [(1R,5R)-5-(hydroxymethyl)-3-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-1-yl]methyl hypoiodite?
The canonical SMILES for [(1R,5R)-5-(hydroxymethyl)-3-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-1-yl]methyl hypoiodite is CC1=C[C@@]2(CO)C=C[C@@](COI)(C1)O2.
What is the InChIKey of [(1R,5R)-5-(hydroxymethyl)-3-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-1-yl]methyl hypoiodite?
The InChIKey is KGAPLTSRTUTHAO-ZJUUUORDSA-N. The full InChI is InChI=1S/C10H13IO3/c1-8-4-9(6-12)2-3-10(5-8,14-9)7-13-11/h2-4,12H,5-7H2,1H3/t9-,10+/m1/s1.
What are the key properties of [(1R,5R)-5-(hydroxymethyl)-3-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-1-yl]methyl hypoiodite?
[(1R,5R)-5-(hydroxymethyl)-3-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-1-yl]methyl hypoiodite has a molecular weight of 308.12 g/mol, XLogP of 1.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,5R)-5-(hydroxymethyl)-3-methyl-8-oxabicyclo[3.2.1]octa-3,6-dien-1-yl]methyl hypoiodite is sourced from PubChem (CID 134172120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).