C30H37N5O4 — CID 134172155
5-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-6-[(2S,7S)-1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-yl]-3-pyridinyl]-1H-imidazole-2-carboxamide (PubChem CID 134172155) has the molecular formula C30H37N5O4 and a molecular weight of 531.66 g/mol. Its IUPAC name is 5-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-6-[(2S,7S)-1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-yl]-3-pyridinyl]-1H-imidazole-2-carboxamide.
| Compound Name | 5-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-6-[(2S,7S)-1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-yl]-3-pyridinyl]-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 134172155 |
| Molecular Formula | C30H37N5O4 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | 5-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-6-[(2S,7S)-1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-yl]-3-pyridinyl]-1H-imidazole-2-carboxamide |
| SMILES | CC1(C)CC=C(c2nc(C3CC4(C)O[C@@](C)(C3)C3OC(C)(C)O[C@@H]34)ccc2NC(=O)c2ncc(C#N)[nH]2)CC1 |
| InChI | InChI=1S/C30H37N5O4/c1-27(2)11-9-17(10-12-27)22-21(35-26(36)25-32-16-19(15-31)33-25)8-7-20(34-22)18-13-29(5)23-24(30(6,14-18)39-29)38-28(3,4)37-23/h7-9,16,18,23-24H,10-14H2,1-6H3,(H,32,33)(H,35,36)/t18?,23-,24?,29?,30-/m0/s1 |
| InChIKey | KQBWZHVBJLXMFF-OZHLNJFCSA-N |
| XLogP | 5.47 |
| TPSA | 122.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |