C24H38N2S — CID 134172210
N'-[(3Z,6E,8Z)-8-[(2Z,4E,6E)-5-methylnona-2,4,6-trien-4-yl]sulfanyldeca-1,3,6,8-tetraen-2-yl]butane-1,4-diamine (PubChem CID 134172210) has the molecular formula C24H38N2S and a molecular weight of 386.65 g/mol. Its IUPAC name is N'-[(3Z,6E,8Z)-8-[(2Z,4E,6E)-5-methylnona-2,4,6-trien-4-yl]sulfanyldeca-1,3,6,8-tetraen-2-yl]butane-1,4-diamine.
| Compound Name | N'-[(3Z,6E,8Z)-8-[(2Z,4E,6E)-5-methylnona-2,4,6-trien-4-yl]sulfanyldeca-1,3,6,8-tetraen-2-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 134172210 |
| Molecular Formula | C24H38N2S |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | N'-[(3Z,6E,8Z)-8-[(2Z,4E,6E)-5-methylnona-2,4,6-trien-4-yl]sulfanyldeca-1,3,6,8-tetraen-2-yl]butane-1,4-diamine |
| SMILES | C=C(/C=C\C/C=C/C(=C/C)SC(/C=C\C)=C(C)/C=C/CC)NCCCCN |
| InChI | InChI=1S/C24H38N2S/c1-6-9-16-21(4)24(15-7-2)27-23(8-3)18-12-10-11-17-22(5)26-20-14-13-19-25/h7-9,11-12,15-18,26H,5-6,10,13-14,19-20,25H2,1-4H3/b15-7-,16-9+,17-11-,18-12+,23-8-,24-21+ |
| InChIKey | BOVDQMVESHRFQV-XVYDXYMFSA-N |
| XLogP | 6.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|