C13H18F6O — CID 134172263
(3E,5E)-9,9,9-trifluoro-2-methoxy-3,8-dimethyl-5-(trifluoromethyl)nona-3,5-diene (PubChem CID 134172263) has the molecular formula C13H18F6O and a molecular weight of 304.27 g/mol. Its IUPAC name is (3E,5E)-9,9,9-trifluoro-2-methoxy-3,8-dimethyl-5-(trifluoromethyl)nona-3,5-diene.
| Compound Name | (3E,5E)-9,9,9-trifluoro-2-methoxy-3,8-dimethyl-5-(trifluoromethyl)nona-3,5-diene |
|---|---|
| PubChem CID | 134172263 |
| Molecular Formula | C13H18F6O |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (3E,5E)-9,9,9-trifluoro-2-methoxy-3,8-dimethyl-5-(trifluoromethyl)nona-3,5-diene |
| SMILES | COC(C)/C(C)=C/C(=C\CC(C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H18F6O/c1-8(10(3)20-4)7-11(13(17,18)19)6-5-9(2)12(14,15)16/h6-7,9-10H,5H2,1-4H3/b8-7+,11-6+ |
| InChIKey | GUGPZMJYOLSFCL-AHMRAIAHSA-N |
| XLogP | 5.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|